C41H53N3O10 — CID 167995313
4-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid;N,N-diethylethanamine (PubChem CID 167995313) has the molecular formula C41H53N3O10 and a molecular weight of 747.89 g/mol. Its IUPAC name is 4-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid;N,N-diethylethanamine.
| Compound Name | 4-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 167995313 |
| Molecular Formula | C41H53N3O10 |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 747.37 |
| IUPAC Name | 4-[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(5-methyl-2,4-dioxo-1,3-diazinan-1-yl)oxolan-3-yl]oxy-4-oxobutanoic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.COc1ccc(C(OC[C@H]2O[C@@H](N3CC(C)C(=O)NC3=O)C[C@@H]2OC(=O)CCC(=O)O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H38N2O10.C6H15N/c1-22-20-37(34(42)36-33(22)41)30-19-28(47-32(40)18-17-31(38)39)29(46-30)21-45-35(23-7-5-4-6-8-23,24-9-13-26(43-2)14-10-24)25-11-15-27(44-3)16-12-25;1-4-7(5-2)6-3/h4-16,22,28-30H,17-21H2,1-3H3,(H,38,39)(H,36,41,42);4-6H2,1-3H3/t22?,28-,29+,30+;/m0./s1 |
| InChIKey | CTVRUHLDIUUOMM-FFIRKDGOSA-N |
| XLogP | 5.44 |
| TPSA | 153.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|