C38H38N2O10 — CID 102303551
[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[(5S,6R)-5,6-dihydroxy-5-methyl-2,4-dioxo-1,3-diazinan-1-yl]oxolan-3-yl] benzoate (PubChem CID 102303551) has the molecular formula C38H38N2O10 and a molecular weight of 682.73 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[(5S,6R)-5,6-dihydroxy-5-methyl-2,4-dioxo-1,3-diazinan-1-yl]oxolan-3-yl] benzoate.
| Compound Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[(5S,6R)-5,6-dihydroxy-5-methyl-2,4-dioxo-1,3-diazinan-1-yl]oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 102303551 |
| Molecular Formula | C38H38N2O10 |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.25 |
| IUPAC Name | [(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[(5S,6R)-5,6-dihydroxy-5-methyl-2,4-dioxo-1,3-diazinan-1-yl]oxolan-3-yl] benzoate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3C(=O)NC(=O)[C@@](C)(O)[C@H]3O)C[C@@H]2OC(=O)c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H38N2O10/c1-37(45)34(42)39-36(44)40(35(37)43)32-22-30(50-33(41)24-10-6-4-7-11-24)31(49-32)23-48-38(25-12-8-5-9-13-25,26-14-18-28(46-2)19-15-26)27-16-20-29(47-3)21-17-27/h4-21,30-32,35,43,45H,22-23H2,1-3H3,(H,39,42,44)/t30-,31+,32+,35+,37+/m0/s1 |
| InChIKey | IYFVKRFEZPMPRZ-KBNXXOHMSA-N |
| XLogP | 3.97 |
| TPSA | 153.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|