C41H40N2O10 — CID 4979069
[2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[3-(4-methoxybenzoyl)-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] acetate (PubChem CID 4979069) has the molecular formula C41H40N2O10 and a molecular weight of 720.78 g/mol. Its IUPAC name is [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[3-(4-methoxybenzoyl)-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] acetate.
| Compound Name | [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[3-(4-methoxybenzoyl)-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 4979069 |
| Molecular Formula | C41H40N2O10 |
| Molecular Weight | 720.78 g/mol |
| Exact Mass | 720.27 |
| IUPAC Name | [2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-[3-(4-methoxybenzoyl)-5-methyl-2,4-dioxopyrimidin-1-yl]oxolan-3-yl] acetate |
| SMILES | COc1ccc(C(=O)n2c(=O)c(C)cn(C3CC(OC(C)=O)C(COC(c4ccccc4)(c4ccc(OC)cc4)c4ccc(OC)cc4)O3)c2=O)cc1 |
| InChI | InChI=1S/C41H40N2O10/c1-26-24-42(40(47)43(38(26)45)39(46)28-11-17-32(48-3)18-12-28)37-23-35(52-27(2)44)36(53-37)25-51-41(29-9-7-6-8-10-29,30-13-19-33(49-4)20-14-30)31-15-21-34(50-5)22-16-31/h6-22,24,35-37H,23,25H2,1-5H3 |
| InChIKey | XLGBXHBEJSUKLL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 133.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.78 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|