C39H39N2O11P — CID 14778879
[(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] methyl hydrogen phosphate (PubChem CID 14778879) has the molecular formula C39H39N2O11P and a molecular weight of 742.72 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] methyl hydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 14778879 |
| Molecular Formula | C39H39N2O11P |
| Molecular Weight | 742.72 g/mol |
| Exact Mass | 742.23 |
| IUPAC Name | [(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl] methyl hydrogen phosphate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)n(C(=O)c4ccccc4)c3=O)C[C@@H]2OP(=O)(O)OC)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H39N2O11P/c1-26-24-40(38(44)41(36(26)42)37(43)27-11-7-5-8-12-27)35-23-33(52-53(45,46)49-4)34(51-35)25-50-39(28-13-9-6-10-14-28,29-15-19-31(47-2)20-16-29)30-17-21-32(48-3)22-18-30/h5-22,24,33-35H,23,25H2,1-4H3,(H,45,46)/t33-,34+,35+/m0/s1 |
| InChIKey | JRGOWJDPEVZDQB-BMPTZRATSA-N |
| XLogP | 5.45 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.72 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|