C38H37N2O9P — CID 102260396
[(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxyphosphinous acid (PubChem CID 102260396) has the molecular formula C38H37N2O9P and a molecular weight of 696.69 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxyphosphinous acid.
| Compound Name | [(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxyphosphinous acid |
|---|---|
| PubChem CID | 102260396 |
| Molecular Formula | C38H37N2O9P |
| Molecular Weight | 696.69 g/mol |
| Exact Mass | 696.22 |
| IUPAC Name | [(2R,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxyphosphinous acid |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cc(C)c(=O)n(C(=O)c4ccccc4)c3=O)C[C@@H]2OPO)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H37N2O9P/c1-25-23-39(37(43)40(35(25)41)36(42)26-10-6-4-7-11-26)34-22-32(49-50-44)33(48-34)24-47-38(27-12-8-5-9-13-27,28-14-18-30(45-2)19-15-28)29-16-20-31(46-3)21-17-29/h4-21,23,32-34,44,50H,22,24H2,1-3H3/t32-,33+,34+/m0/s1 |
| InChIKey | MZMBRSAFXWVFCI-LBFZIJHGSA-N |
| XLogP | 5.21 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|