C24H21BrN2O6 — CID 11260800
[(2S,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-(bromomethyl)oxolan-3-yl] benzoate (PubChem CID 11260800) has the molecular formula C24H21BrN2O6 and a molecular weight of 513.34 g/mol. Its IUPAC name is [(2S,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-(bromomethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2S,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-(bromomethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 11260800 |
| Molecular Formula | C24H21BrN2O6 |
| Molecular Weight | 513.34 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | [(2S,3S,5R)-5-(3-benzoyl-5-methyl-2,4-dioxopyrimidin-1-yl)-2-(bromomethyl)oxolan-3-yl] benzoate |
| SMILES | Cc1cn([C@H]2C[C@H](OC(=O)c3ccccc3)[C@@H](CBr)O2)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C24H21BrN2O6/c1-15-14-26(24(31)27(21(15)28)22(29)16-8-4-2-5-9-16)20-12-18(19(13-25)32-20)33-23(30)17-10-6-3-7-11-17/h2-11,14,18-20H,12-13H2,1H3/t18-,19+,20+/m0/s1 |
| InChIKey | QVGCMTDBNGNSNN-XUVXKRRUSA-N |
| XLogP | 2.91 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|