C23H31N5O5Si — CID 50942260
1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione (PubChem CID 50942260) has the molecular formula C23H31N5O5Si and a molecular weight of 485.62 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 50942260 |
| Molecular Formula | C23H31N5O5Si |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3-benzoyl-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C23H31N5O5Si/c1-15-13-27(22(31)28(20(15)29)21(30)16-10-8-7-9-11-16)19-12-17(25-26-24)18(33-19)14-32-34(5,6)23(2,3)4/h7-11,13,17-19H,12,14H2,1-6H3/t17-,18+,19+/m0/s1 |
| InChIKey | WZUFMQBFHKJYMK-IPMKNSEASA-N |
| XLogP | 4.00 |
| TPSA | 128.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|