C15H25N5O4Si — CID 10785196
1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10785196) has the molecular formula C15H25N5O4Si and a molecular weight of 367.48 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10785196 |
| Molecular Formula | C15H25N5O4Si |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C15H25N5O4Si/c1-15(2,3)25(4,5)23-9-11-10(18-19-16)8-13(24-11)20-7-6-12(21)17-14(20)22/h6-7,10-11,13H,8-9H2,1-5H3,(H,17,21,22)/t10-,11+,13+/m0/s1 |
| InChIKey | WZKSWVAOZGWYCU-DMDPSCGWSA-N |
| XLogP | 2.52 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|