C10H10N6O3 — CID 71340951
1-[4-azido-5-(isocyanomethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 71340951) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-[4-azido-5-(isocyanomethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-azido-5-(isocyanomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71340951 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-[4-azido-5-(isocyanomethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [C-]#[N+]CC1OC(n2ccc(=O)[nH]c2=O)CC1N=[N+]=[N-] |
| InChI | InChI=1S/C10H10N6O3/c1-12-5-7-6(14-15-11)4-9(19-7)16-3-2-8(17)13-10(16)18/h2-3,6-7,9H,4-5H2,(H,13,17,18) |
| InChIKey | IGAWFONCMKMKOH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|