C16H17IN6O5 — CID 14756134
[3-azido-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide (PubChem CID 14756134) has the molecular formula C16H17IN6O5 and a molecular weight of 500.25 g/mol. Its IUPAC name is [3-azido-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide.
| Compound Name | [3-azido-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide |
|---|---|
| PubChem CID | 14756134 |
| Molecular Formula | C16H17IN6O5 |
| Molecular Weight | 500.25 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | [3-azido-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| SMILES | C[n+]1cccc(C(=O)OCC2OC(n3ccc(=O)[nH]c3=O)CC2N=[N+]=[N-])c1.[I-] |
| InChI | InChI=1S/C16H16N6O5.HI/c1-21-5-2-3-10(8-21)15(24)26-9-12-11(19-20-17)7-14(27-12)22-6-4-13(23)18-16(22)25;/h2-6,8,11-12,14H,7,9H2,1H3;1H |
| InChIKey | AKICERUVDURTHB-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.25 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|