C17H14N6O3S2 — CID 10001839
1-[(2R,4S,5R)-4-azido-5-[[1,3-bis(sulfanylidene)isoindol-2-yl]methyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 10001839) has the molecular formula C17H14N6O3S2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-azido-5-[[1,3-bis(sulfanylidene)isoindol-2-yl]methyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-azido-5-[[1,3-bis(sulfanylidene)isoindol-2-yl]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10001839 |
| Molecular Formula | C17H14N6O3S2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 1-[(2R,4S,5R)-4-azido-5-[[1,3-bis(sulfanylidene)isoindol-2-yl]methyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CN1C(=S)c2ccccc2C1=S |
| InChI | InChI=1S/C17H14N6O3S2/c18-21-20-11-7-14(22-6-5-13(24)19-17(22)25)26-12(11)8-23-15(27)9-3-1-2-4-10(9)16(23)28/h1-6,11-12,14H,7-8H2,(H,19,24,25)/t11-,12+,14+/m0/s1 |
| InChIKey | QTTBRCYOVNXILB-OUCADQQQSA-N |
| XLogP | 1.87 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|