C10H13N5O6S — CID 14842989
[(2R,3S,5R)-2-(azidomethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate (PubChem CID 14842989) has the molecular formula C10H13N5O6S and a molecular weight of 331.31 g/mol. Its IUPAC name is [(2R,3S,5R)-2-(azidomethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate.
| Compound Name | [(2R,3S,5R)-2-(azidomethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 14842989 |
| Molecular Formula | C10H13N5O6S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | [(2R,3S,5R)-2-(azidomethyl)-5-(2,4-dioxopyrimidin-1-yl)oxolan-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C10H13N5O6S/c1-22(18,19)21-6-4-9(20-7(6)5-12-14-11)15-3-2-8(16)13-10(15)17/h2-3,6-7,9H,4-5H2,1H3,(H,13,16,17)/t6-,7+,9+/m0/s1 |
| InChIKey | IHHGHPJODWCXIA-LKEWCRSYSA-N |
| XLogP | -0.52 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|