C9H13N2O8P — CID 174149552
[(3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 174149552) has the molecular formula C9H13N2O8P and a molecular weight of 308.18 g/mol. Its IUPAC name is [(3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174149552 |
| Molecular Formula | C9H13N2O8P |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | [(3R,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | O=c1ccn([C@H]2C[C@@H](OP(=O)(O)O)C(CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13N2O8P/c12-4-6-5(19-20(15,16)17)3-8(18-6)11-2-1-7(13)10-9(11)14/h1-2,5-6,8,12H,3-4H2,(H,10,13,14)(H2,15,16,17)/t5-,6?,8-/m1/s1 |
| InChIKey | LXKGKXYIAAKOCT-ONHAXZMJSA-N |
| XLogP | -1.71 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|