C12H14N2O7 — CID 15160541
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] ethenyl carbonate (PubChem CID 15160541) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] ethenyl carbonate.
| Compound Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] ethenyl carbonate |
|---|---|
| PubChem CID | 15160541 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] ethenyl carbonate |
| SMILES | C=COC(=O)O[C@H]1C[C@H](n2ccc(=O)[nH]c2=O)O[C@@H]1CO |
| InChI | InChI=1S/C12H14N2O7/c1-2-19-12(18)21-7-5-10(20-8(7)6-15)14-4-3-9(16)13-11(14)17/h2-4,7-8,10,15H,1,5-6H2,(H,13,16,17)/t7-,8+,10+/m0/s1 |
| InChIKey | QUPUCTKTYCXQGG-QXFUBDJGSA-N |
| XLogP | -0.52 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|