C17H19IN6O5 — CID 10481568
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide (PubChem CID 10481568) has the molecular formula C17H19IN6O5 and a molecular weight of 514.28 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide |
|---|---|
| PubChem CID | 10481568 |
| Molecular Formula | C17H19IN6O5 |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl 1-methylpyridin-1-ium-3-carboxylate iodide |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COC(=O)c3ccc[n+](C)c3)O2)c(=O)[nH]c1=O.[I-] |
| InChI | InChI=1S/C17H18N6O5.HI/c1-10-7-23(17(26)19-15(10)24)14-6-12(20-21-18)13(28-14)9-27-16(25)11-4-3-5-22(2)8-11;/h3-5,7-8,12-14H,6,9H2,1-2H3;1H/t12-,13+,14+;/m0./s1 |
| InChIKey | AUIMKSYHRXGZPG-SOIKFHLCSA-N |
| XLogP | -2.50 |
| TPSA | 143.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|