C19H33N5O4Si — CID 10251724
1-[(2R,4S,5S)-4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione (PubChem CID 10251724) has the molecular formula C19H33N5O4Si and a molecular weight of 423.59 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10251724 |
| Molecular Formula | C19H33N5O4Si |
| Molecular Weight | 423.59 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-5-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-3,5-dimethylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO[Si](C)(C)C(C)(C)C(C)C)O2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C19H33N5O4Si/c1-12(2)19(4,5)29(7,8)27-11-15-14(21-22-20)9-16(28-15)24-10-13(3)17(25)23(6)18(24)26/h10,12,14-16H,9,11H2,1-8H3/t14-,15+,16+/m0/s1 |
| InChIKey | LJFSPRZKLWDYHJ-ARFHVFGLSA-N |
| XLogP | 3.48 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.59 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|