C10H12N6O6 — CID 86573293
1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-nitropyrimidine-2,4-dione (PubChem CID 86573293) has the molecular formula C10H12N6O6 and a molecular weight of 312.24 g/mol. Its IUPAC name is 1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-nitropyrimidine-2,4-dione.
| Compound Name | 1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 86573293 |
| Molecular Formula | C10H12N6O6 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 1-[4-azido-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-3-nitropyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CC(N=[N+]=[N-])C(CO)O2)c(=O)n([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C10H12N6O6/c1-5-3-14(10(19)15(9(5)18)16(20)21)8-2-6(12-13-11)7(4-17)22-8/h3,6-8,17H,2,4H2,1H3 |
| InChIKey | QDGHHNUGFNVEMJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|