C16H26N4O9Si — CID 10647029
[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-3-nitro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] nitrate (PubChem CID 10647029) has the molecular formula C16H26N4O9Si and a molecular weight of 446.49 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-3-nitro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] nitrate.
| Compound Name | [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-3-nitro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] nitrate |
|---|---|
| PubChem CID | 10647029 |
| Molecular Formula | C16H26N4O9Si |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-3-nitro-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] nitrate |
| SMILES | Cc1cn([C@H]2C[C@H](O[N+](=O)[O-])[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)n([N+](=O)[O-])c1=O |
| InChI | InChI=1S/C16H26N4O9Si/c1-10-8-17(15(22)18(14(10)21)19(23)24)13-7-11(29-20(25)26)12(28-13)9-27-30(5,6)16(2,3)4/h8,11-13H,7,9H2,1-6H3/t11-,12+,13+/m0/s1 |
| InChIKey | FMSWIBLHDCUWQR-YNEHKIRRSA-N |
| XLogP | 1.24 |
| TPSA | 157.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|