C23H34N3O9PSi — CID 102410875
[(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-nitrophenyl)methyl hydrogen phosphite (PubChem CID 102410875) has the molecular formula C23H34N3O9PSi and a molecular weight of 555.60 g/mol. Its IUPAC name is [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-nitrophenyl)methyl hydrogen phosphite.
| Compound Name | [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-nitrophenyl)methyl hydrogen phosphite |
|---|---|
| PubChem CID | 102410875 |
| Molecular Formula | C23H34N3O9PSi |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | [(2R,3S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl] (2-nitrophenyl)methyl hydrogen phosphite |
| SMILES | Cc1cn([C@H]2C[C@H](OP(O)OCc3ccccc3[N+](=O)[O-])[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H34N3O9PSi/c1-15-12-25(22(28)24-21(15)27)20-11-18(19(34-20)14-33-37(5,6)23(2,3)4)35-36(31)32-13-16-9-7-8-10-17(16)26(29)30/h7-10,12,18-20,31H,11,13-14H2,1-6H3,(H,24,27,28)/t18-,19+,20+,36?/m0/s1 |
| InChIKey | YCHJCJBFRRXZNF-NHTJKYSWSA-N |
| XLogP | 3.88 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|