C23H36N3O6PSi — CID 101010322
1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 101010322) has the molecular formula C23H36N3O6PSi and a molecular weight of 509.62 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101010322 |
| Molecular Formula | C23H36N3O6PSi |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[anilino(methyl)phosphoryl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](OP(C)(=O)Nc3ccccc3)[C@@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H36N3O6PSi/c1-16-14-26(22(28)24-21(16)27)20-13-18(19(31-20)15-30-34(6,7)23(2,3)4)32-33(5,29)25-17-11-9-8-10-12-17/h8-12,14,18-20H,13,15H2,1-7H3,(H,25,29)(H,24,27,28)/t18-,19+,20+,33?/m0/s1 |
| InChIKey | ZCSSDDALUMFLFV-LAHROCKRSA-N |
| XLogP | 4.47 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|