C24H36N2O5S2Si — CID 11375910
1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methylsulfanylphenyl)sulfanylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11375910) has the molecular formula C24H36N2O5S2Si and a molecular weight of 524.78 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methylsulfanylphenyl)sulfanylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methylsulfanylphenyl)sulfanylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11375910 |
| Molecular Formula | C24H36N2O5S2Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 1-[(2R,4S,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[(2-methylsulfanylphenyl)sulfanylmethoxy]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CSc1ccccc1SCO[C@H]1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H36N2O5S2Si/c1-16-13-26(23(28)25-22(16)27)21-12-17(18(31-21)14-30-34(6,7)24(2,3)4)29-15-33-20-11-9-8-10-19(20)32-5/h8-11,13,17-18,21H,12,14-15H2,1-7H3,(H,25,27,28)/t17-,18+,21+/m0/s1 |
| InChIKey | MSXWOQKGWADWMU-WAOWUJCRSA-N |
| XLogP | 5.01 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|