C16H27IN2O5SSi — CID 140914218
1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione (PubChem CID 140914218) has the molecular formula C16H27IN2O5SSi and a molecular weight of 514.46 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140914218 |
| Molecular Formula | C16H27IN2O5SSi |
| Molecular Weight | 514.46 g/mol |
| Exact Mass | 514.05 |
| IUPAC Name | 1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodopyrimidine-2,4-dione |
| SMILES | CSO[C@@H]1C[C@H](n2cc(I)c(=O)[nH]c2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27IN2O5SSi/c1-16(2,3)26(5,6)22-9-12-11(24-25-4)7-13(23-12)19-8-10(17)14(20)18-15(19)21/h8,11-13H,7,9H2,1-6H3,(H,18,20,21)/t11-,12-,13-/m1/s1 |
| InChIKey | BSOINRIDQMUEJU-JHJVBQTASA-N |
| XLogP | 3.11 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|