C22H41N5O5Si2 — CID 134837835
5-(azidomethyl)-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 134837835) has the molecular formula C22H41N5O5Si2 and a molecular weight of 511.77 g/mol. Its IUPAC name is 5-(azidomethyl)-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(azidomethyl)-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134837835 |
| Molecular Formula | C22H41N5O5Si2 |
| Molecular Weight | 511.77 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 5-(azidomethyl)-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cc(CN=[N+]=[N-])c(=O)[nH]c2=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41N5O5Si2/c1-21(2,3)33(7,8)30-14-17-16(32-34(9,10)22(4,5)6)11-18(31-17)27-13-15(12-24-26-23)19(28)25-20(27)29/h13,16-18H,11-12,14H2,1-10H3,(H,25,28,29)/t16-,17-,18-/m1/s1 |
| InChIKey | CVJSTVBOLCMJGT-KZNAEPCWSA-N |
| XLogP | 5.05 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.77 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|