C31H49N3O6Si2 — CID 59336560
5-[3-(benzylamino)oxyprop-1-ynyl]-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 59336560) has the molecular formula C31H49N3O6Si2 and a molecular weight of 615.92 g/mol. Its IUPAC name is 5-[3-(benzylamino)oxyprop-1-ynyl]-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-[3-(benzylamino)oxyprop-1-ynyl]-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 59336560 |
| Molecular Formula | C31H49N3O6Si2 |
| Molecular Weight | 615.92 g/mol |
| Exact Mass | 615.32 |
| IUPAC Name | 5-[3-(benzylamino)oxyprop-1-ynyl]-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(dimethyl)silyl]oxymethyl]oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](n2cc(C#CCONCc3ccccc3)c(=O)[nH]c2=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H49N3O6Si2/c1-30(2,3)41(7,8)38-22-26-25(40-42(9,10)31(4,5)6)19-27(39-26)34-21-24(28(35)33-29(34)36)17-14-18-37-32-20-23-15-12-11-13-16-23/h11-13,15-16,21,25-27,32H,18-20,22H2,1-10H3,(H,33,35,36)/t25-,26-,27-/m1/s1 |
| InChIKey | YIYHEDHLWPMBKT-ZONZVBGPSA-N |
| XLogP | 5.31 |
| TPSA | 103.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|