C37H47N3O8Si — CID 163598230
tert-butyl N-[3-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-oxobutoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]carbamate (PubChem CID 163598230) has the molecular formula C37H47N3O8Si and a molecular weight of 689.88 g/mol. Its IUPAC name is tert-butyl N-[3-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-oxobutoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-oxobutoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 163598230 |
| Molecular Formula | C37H47N3O8Si |
| Molecular Weight | 689.88 g/mol |
| Exact Mass | 689.31 |
| IUPAC Name | tert-butyl N-[3-[1-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(3-oxobutoxy)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]carbamate |
| SMILES | CC(=O)CCOC1C[C@H](n2cc(C#CCNC(=O)OC(C)(C)C)c(=O)[nH]c2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C37H47N3O8Si/c1-26(41)20-22-45-30-23-32(40-24-27(33(42)39-34(40)43)15-14-21-38-35(44)48-36(2,3)4)47-31(30)25-46-49(37(5,6)7,28-16-10-8-11-17-28)29-18-12-9-13-19-29/h8-13,16-19,24,30-32H,20-23,25H2,1-7H3,(H,38,44)(H,39,42,43)/t30?,31-,32-/m1/s1 |
| InChIKey | KMOMRZANMOJXCS-YPHBKRNWSA-N |
| XLogP | 3.64 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|