C37H46N2O9SSi — CID 157098373
2-[2-acetyloxy-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-but-1-ynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl]sulfanylethyl acetate (PubChem CID 157098373) has the molecular formula C37H46N2O9SSi and a molecular weight of 722.93 g/mol. Its IUPAC name is 2-[2-acetyloxy-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-but-1-ynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl]sulfanylethyl acetate.
| Compound Name | 2-[2-acetyloxy-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-but-1-ynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl]sulfanylethyl acetate |
|---|---|
| PubChem CID | 157098373 |
| Molecular Formula | C37H46N2O9SSi |
| Molecular Weight | 722.93 g/mol |
| Exact Mass | 722.27 |
| IUPAC Name | 2-[2-acetyloxy-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-but-1-ynyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl]sulfanylethyl acetate |
| SMILES | CCC#Cc1cn([C@H]2CC(OC(COC(C)=O)SCCOC(C)=O)[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C37H46N2O9SSi/c1-7-8-15-28-23-39(36(43)38-35(28)42)33-22-31(48-34(25-45-27(3)41)49-21-20-44-26(2)40)32(47-33)24-46-50(37(4,5)6,29-16-11-9-12-17-29)30-18-13-10-14-19-30/h9-14,16-19,23,31-34H,7,20-22,24-25H2,1-6H3,(H,38,42,43)/t31?,32-,33-,34?/m1/s1 |
| InChIKey | MWTPHZWLMMOBGV-LDACPSTQSA-N |
| XLogP | 3.73 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|