C30H37BrN2O6SSi — CID 176850640
S-[2-bromo-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl] ethanethioate (PubChem CID 176850640) has the molecular formula C30H37BrN2O6SSi and a molecular weight of 661.69 g/mol. Its IUPAC name is S-[2-bromo-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl] ethanethioate.
| Compound Name | S-[2-bromo-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl] ethanethioate |
|---|---|
| PubChem CID | 176850640 |
| Molecular Formula | C30H37BrN2O6SSi |
| Molecular Weight | 661.69 g/mol |
| Exact Mass | 660.13 |
| IUPAC Name | S-[2-bromo-1-[(2R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]oxyethyl] ethanethioate |
| SMILES | CC(=O)SC(CBr)OC1C[C@H](n2cc(C)c(=O)[nH]c2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H37BrN2O6SSi/c1-20-18-33(29(36)32-28(20)35)26-16-24(39-27(17-31)40-21(2)34)25(38-26)19-37-41(30(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,18,24-27H,16-17,19H2,1-5H3,(H,32,35,36)/t24?,25-,26-,27?/m1/s1 |
| InChIKey | UOHKBDRCEOQTBF-YBSSSUDZSA-N |
| XLogP | 4.10 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.69 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|