C26H33N2O8PSi — CID 101004656
[(S)-[(2S,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid (PubChem CID 101004656) has the molecular formula C26H33N2O8PSi and a molecular weight of 560.62 g/mol. Its IUPAC name is [(S)-[(2S,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid.
| Compound Name | [(S)-[(2S,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 101004656 |
| Molecular Formula | C26H33N2O8PSi |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | [(S)-[(2S,3S,5R)-3-[tert-butyl(diphenyl)silyl]oxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]([C@@H](O)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C26H33N2O8PSi/c1-17-16-28(25(31)27-23(17)29)21-15-20(22(35-21)24(30)37(32,33)34)36-38(26(2,3)4,18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,16,20-22,24,30H,15H2,1-4H3,(H,27,29,31)(H2,32,33,34)/t20-,21+,22-,24-/m0/s1 |
| InChIKey | NJNQZIRALALNQZ-KHUIQGCPSA-N |
| XLogP | 1.57 |
| TPSA | 151.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|