C10H14FN2O7P — CID 69200333
[[(2S,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid (PubChem CID 69200333) has the molecular formula C10H14FN2O7P and a molecular weight of 324.20 g/mol. Its IUPAC name is [[(2S,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid.
| Compound Name | [[(2S,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 69200333 |
| Molecular Formula | C10H14FN2O7P |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [[(2S,3S,5R)-3-fluoro-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](F)[C@@H](C(O)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14FN2O7P/c1-4-3-13(10(16)12-8(4)14)6-2-5(11)7(20-6)9(15)21(17,18)19/h3,5-7,9,15H,2H2,1H3,(H,12,14,16)(H2,17,18,19)/t5-,6+,7-,9?/m0/s1 |
| InChIKey | DREDUMSAONLSEG-WPRFRAJKSA-N |
| XLogP | -1.03 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|