C16H28N2O5Si — CID 22883960
1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 22883960) has the molecular formula C16H28N2O5Si and a molecular weight of 356.50 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22883960 |
| Molecular Formula | C16H28N2O5Si |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 1-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](C(O)[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H28N2O5Si/c1-9-8-18(15(22)17-13(9)20)11-7-10(19)12(23-11)14(21)24(5,6)16(2,3)4/h8,10-12,14,19,21H,7H2,1-6H3,(H,17,20,22)/t10-,11+,12-,14?/m0/s1 |
| InChIKey | YBWTWVJOZHLREZ-JACPFSORSA-N |
| XLogP | 0.90 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|