C16H26N4O4Si — CID 175717588
9-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 175717588) has the molecular formula C16H26N4O4Si and a molecular weight of 366.49 g/mol. Its IUPAC name is 9-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 175717588 |
| Molecular Formula | C16H26N4O4Si |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 9-[(2R,4S,5S)-5-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | CC(C)(C)[Si](C)(C)C(O)[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)C[C@@H]1O |
| InChI | InChI=1S/C16H26N4O4Si/c1-16(2,3)25(4,5)15(23)12-9(21)6-10(24-12)20-8-19-11-13(20)17-7-18-14(11)22/h7-10,12,15,21,23H,6H2,1-5H3,(H,17,18,22)/t9-,10+,12-,15?/m0/s1 |
| InChIKey | YIVPGMQZTZVKSX-SCYBJBRLSA-N |
| XLogP | 1.18 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|