C10H14N6O4 — CID 175719934
2-amino-9-[(2R,4S,5S)-5-[amino(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 175719934) has the molecular formula C10H14N6O4 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5S)-5-[amino(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5S)-5-[amino(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 175719934 |
| Molecular Formula | C10H14N6O4 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-amino-9-[(2R,4S,5S)-5-[amino(hydroxy)methyl]-4-hydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](C(N)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N6O4/c11-7(18)6-3(17)1-4(20-6)16-2-13-5-8(16)14-10(12)15-9(5)19/h2-4,6-7,17-18H,1,11H2,(H3,12,14,15,19)/t3-,4+,6-,7?/m0/s1 |
| InChIKey | YDUDBKOLHRVGCF-DBSCUUFBSA-N |
| XLogP | -2.37 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|