C10H14N5O7P — CID 174812029
[[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-hydroxymethyl]phosphonic acid (PubChem CID 174812029) has the molecular formula C10H14N5O7P and a molecular weight of 347.22 g/mol. Its IUPAC name is [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-hydroxymethyl]phosphonic acid.
| Compound Name | [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-hydroxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 174812029 |
| Molecular Formula | C10H14N5O7P |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-hydroxymethyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](C(O)P(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N5O7P/c11-10-13-7-5(8(17)14-10)12-2-15(7)4-1-3(16)6(22-4)9(18)23(19,20)21/h2-4,6,9,16,18H,1H2,(H2,19,20,21)(H3,11,13,14,17)/t3-,4+,6-,9?/m0/s1 |
| InChIKey | SPENAAAPICKMOE-MPWJDEBYSA-N |
| XLogP | -2.15 |
| TPSA | 196.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|