C10H15N5O11P2 — CID 135600342
[[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-phosphonooxymethyl] dihydrogen phosphate (PubChem CID 135600342) has the molecular formula C10H15N5O11P2 and a molecular weight of 443.20 g/mol. Its IUPAC name is [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-phosphonooxymethyl] dihydrogen phosphate.
| Compound Name | [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-phosphonooxymethyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 135600342 |
| Molecular Formula | C10H15N5O11P2 |
| Molecular Weight | 443.20 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | [[(2S,3S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]-phosphonooxymethyl] dihydrogen phosphate |
| SMILES | Nc1nc2c(ncn2[C@H]2C[C@H](O)[C@@H](C(OP(=O)(O)O)OP(=O)(O)O)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N5O11P2/c11-10-13-7-5(8(17)14-10)12-2-15(7)4-1-3(16)6(24-4)9(25-27(18,19)20)26-28(21,22)23/h2-4,6,9,16H,1H2,(H2,18,19,20)(H2,21,22,23)(H3,11,13,14,17)/t3-,4+,6-/m0/s1 |
| InChIKey | JUPWAMVUQSUYGY-RPDRRWSUSA-N |
| XLogP | -2.11 |
| TPSA | 252.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.20 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|