C13H17N5O4 — CID 135493687
N-[2-(1-hydroxyethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]acetamide (PubChem CID 135493687) has the molecular formula C13H17N5O4 and a molecular weight of 307.31 g/mol. Its IUPAC name is N-[2-(1-hydroxyethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]acetamide.
| Compound Name | N-[2-(1-hydroxyethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 135493687 |
| Molecular Formula | C13H17N5O4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-[2-(1-hydroxyethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]acetamide |
| SMILES | CC(=O)NC1CC(n2cnc3c(=O)[nH]cnc32)OC1C(C)O |
| InChI | InChI=1S/C13H17N5O4/c1-6(19)11-8(17-7(2)20)3-9(22-11)18-5-16-10-12(18)14-4-15-13(10)21/h4-6,8-9,11,19H,3H2,1-2H3,(H,17,20)(H,14,15,21) |
| InChIKey | YBXUVZCODIRMDZ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |