C16H27N2O7P — CID 162358254
1-[(2R,5R)-5-[(2S)-1-diethoxyphosphorylpropan-2-yl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 162358254) has the molecular formula C16H27N2O7P and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-[(2R,5R)-5-[(2S)-1-diethoxyphosphorylpropan-2-yl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5R)-5-[(2S)-1-diethoxyphosphorylpropan-2-yl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 162358254 |
| Molecular Formula | C16H27N2O7P |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(2R,5R)-5-[(2S)-1-diethoxyphosphorylpropan-2-yl]-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(C[C@@H](C)[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)CC1O)OCC |
| InChI | InChI=1S/C16H27N2O7P/c1-5-23-26(22,24-6-2)9-11(4)14-12(19)7-13(25-14)18-8-10(3)15(20)17-16(18)21/h8,11-14,19H,5-7,9H2,1-4H3,(H,17,20,21)/t11-,12?,13-,14-/m1/s1 |
| InChIKey | KHHRWIJMRVGAGM-ZXCYLUJYSA-N |
| XLogP | 1.40 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|