C16H27N2O6P — CID 88880803
1-[(2R,5S)-5-[(2R)-1-diethoxyphosphorylpropan-2-yl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 88880803) has the molecular formula C16H27N2O6P and a molecular weight of 374.37 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[(2R)-1-diethoxyphosphorylpropan-2-yl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[(2R)-1-diethoxyphosphorylpropan-2-yl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88880803 |
| Molecular Formula | C16H27N2O6P |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1-[(2R,5S)-5-[(2R)-1-diethoxyphosphorylpropan-2-yl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(C[C@H](C)[C@@H]1CC[C@H](n2cc(C)c(=O)[nH]c2=O)O1)OCC |
| InChI | InChI=1S/C16H27N2O6P/c1-5-22-25(21,23-6-2)10-12(4)13-7-8-14(24-13)18-9-11(3)15(19)17-16(18)20/h9,12-14H,5-8,10H2,1-4H3,(H,17,19,20)/t12-,13-,14+/m0/s1 |
| InChIKey | HCJUFKUGXFQGPJ-MELADBBJSA-N |
| XLogP | 2.42 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|