C14H23N2O7P — CID 90704057
1-[(4R,5S)-5-(diethoxyphosphorylmethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 90704057) has the molecular formula C14H23N2O7P and a molecular weight of 362.32 g/mol. Its IUPAC name is 1-[(4R,5S)-5-(diethoxyphosphorylmethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(4R,5S)-5-(diethoxyphosphorylmethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 90704057 |
| Molecular Formula | C14H23N2O7P |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 1-[(4R,5S)-5-(diethoxyphosphorylmethyl)-4-hydroxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CCOP(=O)(C[C@H]1OC(n2cc(C)c(=O)[nH]c2=O)C[C@H]1O)OCC |
| InChI | InChI=1S/C14H23N2O7P/c1-4-21-24(20,22-5-2)8-11-10(17)6-12(23-11)16-7-9(3)13(18)15-14(16)19/h7,10-12,17H,4-6,8H2,1-3H3,(H,15,18,19)/t10-,11-,12?/m1/s1 |
| InChIKey | VGJNLLZZRPXGDR-XFKKCKKNSA-N |
| XLogP | 0.76 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|