C33H47BrN2O5Si2 — CID 10628391
1-[(2R,4S,5S)-5-[(1S)-1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10628391) has the molecular formula C33H47BrN2O5Si2 and a molecular weight of 687.82 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-5-[(1S)-1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-5-[(1S)-1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10628391 |
| Molecular Formula | C33H47BrN2O5Si2 |
| Molecular Weight | 687.82 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | 1-[(2R,4S,5S)-5-[(1S)-1-bromo-2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-[tert-butyl(diphenyl)silyl]oxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@@H]([C@@H](Br)CO[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C33H47BrN2O5Si2/c1-23-21-36(31(38)35-30(23)37)28-20-27(29(40-28)26(34)22-39-42(8,9)32(2,3)4)41-43(33(5,6)7,24-16-12-10-13-17-24)25-18-14-11-15-19-25/h10-19,21,26-29H,20,22H2,1-9H3,(H,35,37,38)/t26-,27-,28+,29+/m0/s1 |
| InChIKey | RKHKDKTWEHXUDZ-QUAHOIDUSA-N |
| XLogP | 5.86 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.82 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|