C25H30N2O4SSi — CID 10368003
1-[(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10368003) has the molecular formula C25H30N2O4SSi and a molecular weight of 482.68 g/mol. Its IUPAC name is 1-[(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10368003 |
| Molecular Formula | C25H30N2O4SSi |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 1-[(2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn(C2CS[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H30N2O4SSi/c1-18-15-27(24(29)26-23(18)28)21-17-32-22(31-21)16-30-33(25(2,3)4,19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-15,21-22H,16-17H2,1-4H3,(H,26,28,29)/t21?,22-/m1/s1 |
| InChIKey | WRHHLLJHQKRDPN-FOIFJWKZSA-N |
| XLogP | 3.01 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|