C27H32N2O4Si — CID 10695945
1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10695945) has the molecular formula C27H32N2O4Si and a molecular weight of 476.65 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10695945 |
| Molecular Formula | C27H32N2O4Si |
| Molecular Weight | 476.65 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-[(2R,5S)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-methyl-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CC1=C[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H32N2O4Si/c1-19-16-21(33-25(19)29-17-20(2)24(30)28-26(29)31)18-32-34(27(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-17,21,25H,18H2,1-5H3,(H,28,30,31)/t21-,25+/m0/s1 |
| InChIKey | HAXLXFWUFNTLMQ-SQJMNOBHSA-N |
| XLogP | 3.27 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|