C32H35N3O4SSi — CID 10077037
N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide (PubChem CID 10077037) has the molecular formula C32H35N3O4SSi and a molecular weight of 585.80 g/mol. Its IUPAC name is N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 10077037 |
| Molecular Formula | C32H35N3O4SSi |
| Molecular Weight | 585.80 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | N-[1-[(2R,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-5-methyl-2-oxopyrimidin-4-yl]benzamide |
| SMILES | Cc1cn([C@@H]2CS[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c(=O)nc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C32H35N3O4SSi/c1-23-20-35(31(37)34-29(23)33-30(36)24-14-8-5-9-15-24)27-22-40-28(39-27)21-38-41(32(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-20,27-28H,21-22H2,1-4H3,(H,33,34,36,37)/t27-,28+/m0/s1 |
| InChIKey | CVBPGNUUNYDCEM-WUFINQPMSA-N |
| XLogP | 4.97 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.80 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|