C33H46N3O8PSSi — CID 10032690
4-[[1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]amino]butyl diethoxyphosphorylformate (PubChem CID 10032690) has the molecular formula C33H46N3O8PSSi and a molecular weight of 703.87 g/mol. Its IUPAC name is 4-[[1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]amino]butyl diethoxyphosphorylformate.
| Compound Name | 4-[[1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]amino]butyl diethoxyphosphorylformate |
|---|---|
| PubChem CID | 10032690 |
| Molecular Formula | C33H46N3O8PSSi |
| Molecular Weight | 703.87 g/mol |
| Exact Mass | 703.25 |
| IUPAC Name | 4-[[1-[(2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]amino]butyl diethoxyphosphorylformate |
| SMILES | CCOP(=O)(OCC)C(=O)OCCCCNc1ccn([C@H]2CS[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)c(=O)n1 |
| InChI | InChI=1S/C33H46N3O8PSSi/c1-6-41-45(39,42-7-2)32(38)40-23-15-14-21-34-28-20-22-36(31(37)35-28)29-25-46-30(44-29)24-43-47(33(3,4)5,26-16-10-8-11-17-26)27-18-12-9-13-19-27/h8-13,16-20,22,29-30H,6-7,14-15,21,23-25H2,1-5H3,(H,34,35,37)/t29-,30+/m1/s1 |
| InChIKey | DKFPRPSXRKJBRA-IHLOFXLRSA-N |
| XLogP | 6.00 |
| TPSA | 127.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.87 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|