C29H40N3O7PSi — CID 10722307
4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-diethoxyphosphoryl-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 10722307) has the molecular formula C29H40N3O7PSi and a molecular weight of 601.71 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-diethoxyphosphoryl-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-diethoxyphosphoryl-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10722307 |
| Molecular Formula | C29H40N3O7PSi |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-diethoxyphosphoryl-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CCOP(=O)(OCC)[C@@]1(O)C[C@H](n2ccc(N)nc2=O)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H40N3O7PSi/c1-6-36-40(35,37-7-2)29(34)20-26(32-19-18-25(30)31-27(32)33)39-24(29)21-38-41(28(3,4)5,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-19,24,26,34H,6-7,20-21H2,1-5H3,(H2,30,31,33)/t24-,26-,29+/m1/s1 |
| InChIKey | PUPXWTIEPFPFTB-YPZXTKLSSA-N |
| XLogP | 3.64 |
| TPSA | 135.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|