C41H50N4O4Si2 — CID 10580719
4-amino-1-[(2R,4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxyamino]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 10580719) has the molecular formula C41H50N4O4Si2 and a molecular weight of 719.05 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxyamino]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxyamino]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 10580719 |
| Molecular Formula | C41H50N4O4Si2 |
| Molecular Weight | 719.05 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | 4-amino-1-[(2R,4S,5S)-4-[[tert-butyl(diphenyl)silyl]oxyamino]-5-[[tert-butyl(diphenyl)silyl]oxymethyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@@H]1NO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H50N4O4Si2/c1-40(2,3)50(31-19-11-7-12-20-31,32-21-13-8-14-22-32)47-30-36-35(29-38(48-36)45-28-27-37(42)43-39(45)46)44-49-51(41(4,5)6,33-23-15-9-16-24-33)34-25-17-10-18-26-34/h7-28,35-36,38,44H,29-30H2,1-6H3,(H2,42,43,46)/t35-,36+,38+/m0/s1 |
| InChIKey | REWDPDBIWHJKBF-QOZRZDGHSA-N |
| XLogP | 5.14 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.05 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|