C25H31N3O4Si — CID 150696636
4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one (PubChem CID 150696636) has the molecular formula C25H31N3O4Si and a molecular weight of 465.63 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 150696636 |
| Molecular Formula | C25H31N3O4Si |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C[C@@H]1O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O4Si/c1-25(2,3)33(18-10-6-4-7-11-18,19-12-8-5-9-13-19)31-17-21-20(29)16-23(32-21)28-15-14-22(26)27-24(28)30/h4-15,20-21,23,29H,16-17H2,1-3H3,(H2,26,27,30)/t20-,21+,23+/m0/s1 |
| InChIKey | JKZFAPFTDSHITQ-QZNHQXDQSA-N |
| XLogP | 2.05 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|