C25H31N3O2SSi — CID 70284737
4-amino-1-[(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one (PubChem CID 70284737) has the molecular formula C25H31N3O2SSi and a molecular weight of 465.70 g/mol. Its IUPAC name is 4-amino-1-[(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 70284737 |
| Molecular Formula | C25H31N3O2SSi |
| Molecular Weight | 465.70 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 4-amino-1-[(5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]thiolan-2-yl]pyrimidin-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1CCC(n2ccc(N)nc2=O)S1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31N3O2SSi/c1-25(2,3)32(20-10-6-4-7-11-20,21-12-8-5-9-13-21)30-18-19-14-15-23(31-19)28-17-16-22(26)27-24(28)29/h4-13,16-17,19,23H,14-15,18H2,1-3H3,(H2,26,27,29)/t19-,23?/m1/s1 |
| InChIKey | GPFLQIKEYCBHMN-HWYAHNCWSA-N |
| XLogP | 3.80 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.70 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|