C33H45F2N3O4Si2 — CID 175677908
4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3,3-difluorooxolan-2-yl]pyrimidin-2-one (PubChem CID 175677908) has the molecular formula C33H45F2N3O4Si2 and a molecular weight of 641.91 g/mol. Its IUPAC name is 4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3,3-difluorooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3,3-difluorooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 175677908 |
| Molecular Formula | C33H45F2N3O4Si2 |
| Molecular Weight | 641.91 g/mol |
| Exact Mass | 641.29 |
| IUPAC Name | 4-amino-1-[(2R,4R,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-ethenyl-3,3-difluorooxolan-2-yl]pyrimidin-2-one |
| SMILES | C=C[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](n2ccc(N)nc2=O)C(F)(F)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H45F2N3O4Si2/c1-10-32(23-40-44(31(5,6)7,24-17-13-11-14-18-24)25-19-15-12-16-20-25)27(42-43(8,9)30(2,3)4)33(34,35)28(41-32)38-22-21-26(36)37-29(38)39/h10-22,27-28H,1,23H2,2-9H3,(H2,36,37,39)/t27-,28-,32-/m1/s1 |
| InChIKey | TVJVVUOKMYYEAN-DMBDEWFESA-N |
| XLogP | 5.88 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.91 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|