C35H50FN3O4Si2 — CID 175677917
4-amino-1-[(2R,3R,4R,5R)-5-[(E)-but-1-enyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]pyrimidin-2-one (PubChem CID 175677917) has the molecular formula C35H50FN3O4Si2 and a molecular weight of 651.97 g/mol. Its IUPAC name is 4-amino-1-[(2R,3R,4R,5R)-5-[(E)-but-1-enyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(2R,3R,4R,5R)-5-[(E)-but-1-enyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 175677917 |
| Molecular Formula | C35H50FN3O4Si2 |
| Molecular Weight | 651.97 g/mol |
| Exact Mass | 651.33 |
| IUPAC Name | 4-amino-1-[(2R,3R,4R,5R)-5-[(E)-but-1-enyl]-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-fluorooxolan-2-yl]pyrimidin-2-one |
| SMILES | CC/C=C/[C@]1(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](n2ccc(N)nc2=O)[C@H](F)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H50FN3O4Si2/c1-10-11-23-35(25-41-45(34(5,6)7,26-18-14-12-15-19-26)27-20-16-13-17-21-27)30(43-44(8,9)33(2,3)4)29(36)31(42-35)39-24-22-28(37)38-32(39)40/h11-24,29-31H,10,25H2,1-9H3,(H2,37,38,40)/b23-11+/t29-,30+,31-,35-/m1/s1 |
| InChIKey | DGCSBPCYELCDAI-DMLIPJIJSA-N |
| XLogP | 6.36 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|