C39H50N4O6Si2 — CID 10509123
N-[1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-hydroxyiminomethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide (PubChem CID 10509123) has the molecular formula C39H50N4O6Si2 and a molecular weight of 727.02 g/mol. Its IUPAC name is N-[1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-hydroxyiminomethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide.
| Compound Name | N-[1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-hydroxyiminomethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 10509123 |
| Molecular Formula | C39H50N4O6Si2 |
| Molecular Weight | 727.02 g/mol |
| Exact Mass | 726.33 |
| IUPAC Name | N-[1-[(2R,4S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E)-hydroxyiminomethyl]oxolan-2-yl]-2-oxopyrimidin-4-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](n2ccc(NC(=O)c3ccccc3)nc2=O)O[C@]1(/C=N/O)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H50N4O6Si2/c1-37(2,3)50(7,8)49-32-26-34(43-25-24-33(42-36(43)45)41-35(44)29-18-12-9-13-19-29)48-39(32,27-40-46)28-47-51(38(4,5)6,30-20-14-10-15-21-30)31-22-16-11-17-23-31/h9-25,27,32,34,46H,26,28H2,1-8H3,(H,41,42,44,45)/b40-27+/t32-,34+,39+/m0/s1 |
| InChIKey | WBQFTGXXOOZVKY-KLHYUTRVSA-N |
| XLogP | 6.58 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.02 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|